About 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide
2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide (PubChem CID 106509833) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide.
Molecular Properties
| Compound Name | 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide |
| PubChem CID | 106509833 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide |
| SMILES | CC(C)(O)C(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C12H19NO2/c1-12(2,15)11(14)13-10-8-6-3-4-7(5-6)9(8)10/h6-10,15H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | OLCMYDXFYMPPFB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide?
The IUPAC name of 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide (CID 106509833) is 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide.
What is the SMILES notation for 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide?
The canonical SMILES for 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide is CC(C)(O)C(=O)NC1C2C3CCC(C3)C12.
What is the InChIKey of 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide?
The InChIKey is OLCMYDXFYMPPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-12(2,15)11(14)13-10-8-6-3-4-7(5-6)9(8)10/h6-10,15H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide?
2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide has a molecular weight of 209.29 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide is sourced from PubChem (CID 106509833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).