C12H20N2O — CID 103798203
4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide (PubChem CID 103798203) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide.
| Compound Name | 4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide |
|---|---|
| PubChem CID | 103798203 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-amino-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide |
| SMILES | NCCCC(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C12H20N2O/c13-5-1-2-9(15)14-12-10-7-3-4-8(6-7)11(10)12/h7-8,10-12H,1-6,13H2,(H,14,15) |
| InChIKey | PREQYERDEBKLEH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |