C7H16N2O2S — CID 103796520
(2R)-2-amino-N-(2-ethylsulfinylethyl)propanamide (PubChem CID 103796520) has the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-ethylsulfinylethyl)propanamide.
| Compound Name | (2R)-2-amino-N-(2-ethylsulfinylethyl)propanamide |
|---|---|
| PubChem CID | 103796520 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (2R)-2-amino-N-(2-ethylsulfinylethyl)propanamide |
| SMILES | CCS(=O)CCNC(=O)[C@@H](C)N |
| InChI | InChI=1S/C7H16N2O2S/c1-3-12(11)5-4-9-7(10)6(2)8/h6H,3-5,8H2,1-2H3,(H,9,10)/t6-,12?/m1/s1 |
| InChIKey | OOQQZLMDIASFNA-ZJGHLTBISA-N |
| XLogP | -0.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |