C9H17NO3S — CID 103799843
N-(2-hydroxyethyl)-2-(oxolan-2-ylmethylsulfanyl)acetamide (PubChem CID 103799843) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-(oxolan-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-(oxolan-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 103799843 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-(2-hydroxyethyl)-2-(oxolan-2-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCC1CCCO1)NCCO |
| InChI | InChI=1S/C9H17NO3S/c11-4-3-10-9(12)7-14-6-8-2-1-5-13-8/h8,11H,1-7H2,(H,10,12) |
| InChIKey | UOSKTSAMYIGWQR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |