C17H33ClN2O2S — CID 119620861
N-[2-(cycloheptylamino)ethyl]-2-(oxan-2-ylmethylsulfanyl)acetamide;hydrochloride (PubChem CID 119620861) has the molecular formula C17H33ClN2O2S and a molecular weight of 364.98 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-(oxan-2-ylmethylsulfanyl)acetamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-(oxan-2-ylmethylsulfanyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119620861 |
| Molecular Formula | C17H33ClN2O2S |
| Molecular Weight | 364.98 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-(oxan-2-ylmethylsulfanyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CSCC1CCCCO1)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C17H32N2O2S.ClH/c20-17(14-22-13-16-9-5-6-12-21-16)19-11-10-18-15-7-3-1-2-4-8-15;/h15-16,18H,1-14H2,(H,19,20);1H |
| InChIKey | OCILUCONRPEWGV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.98 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|