C11H19NO2 — CID 103800053
(E)-N-[[1-(2-methoxyethyl)cyclopropyl]methyl]but-2-enamide (PubChem CID 103800053) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (E)-N-[[1-(2-methoxyethyl)cyclopropyl]methyl]but-2-enamide.
| Compound Name | (E)-N-[[1-(2-methoxyethyl)cyclopropyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 103800053 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (E)-N-[[1-(2-methoxyethyl)cyclopropyl]methyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCC1(CCOC)CC1 |
| InChI | InChI=1S/C11H19NO2/c1-3-4-10(13)12-9-11(5-6-11)7-8-14-2/h3-4H,5-9H2,1-2H3,(H,12,13)/b4-3+ |
| InChIKey | LHPOVEGFYMKEJT-ONEGZZNKSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|