C12H24N2O2 — CID 103800433
1,1-diethyl-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea (PubChem CID 103800433) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1,1-diethyl-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea.
| Compound Name | 1,1-diethyl-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 103800433 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1,1-diethyl-3-[[1-(2-methoxyethyl)cyclopropyl]methyl]urea |
| SMILES | CCN(CC)C(=O)NCC1(CCOC)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-4-14(5-2)11(15)13-10-12(6-7-12)8-9-16-3/h4-10H2,1-3H3,(H,13,15) |
| InChIKey | GUKCEVRSPJMGAU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |