C13H17ClFNO3S — CID 103801304
2-(2-chloro-4-fluorophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)acetamide (PubChem CID 103801304) has the molecular formula C13H17ClFNO3S and a molecular weight of 321.80 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 103801304 |
| Molecular Formula | C13H17ClFNO3S |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)acetamide |
| SMILES | CSC(CO)C(C)NC(=O)COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H17ClFNO3S/c1-8(12(6-17)20-2)16-13(18)7-19-11-4-3-9(15)5-10(11)14/h3-5,8,12,17H,6-7H2,1-2H3,(H,16,18) |
| InChIKey | NETOGZOIYQTOOV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |