C17H17ClFNO2S — CID 46440609
2-(2-chloro-4-fluorophenoxy)-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide (PubChem CID 46440609) has the molecular formula C17H17ClFNO2S and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46440609 |
| Molecular Formula | C17H17ClFNO2S |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-[1-(4-methylsulfanylphenyl)ethyl]acetamide |
| SMILES | CSc1ccc(C(C)NC(=O)COc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClFNO2S/c1-11(12-3-6-14(23-2)7-4-12)20-17(21)10-22-16-8-5-13(19)9-15(16)18/h3-9,11H,10H2,1-2H3,(H,20,21) |
| InChIKey | UATCYCUEMGTREX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |