C15H19NO2S2 — CID 103801431
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 103801431) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103801431 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)c1sc2ccccc2c1C |
| InChI | InChI=1S/C15H19NO2S2/c1-9-11-6-4-5-7-12(11)20-14(9)15(18)16-10(2)13(8-17)19-3/h4-7,10,13,17H,8H2,1-3H3,(H,16,18) |
| InChIKey | IWXXSNWWGHWDGG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |