C17H16N2O3S2 — CID 76780138
N-[1-[5-(hydroxycarbamoyl)thiophen-2-yl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 76780138) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[1-[5-(hydroxycarbamoyl)thiophen-2-yl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-[5-(hydroxycarbamoyl)thiophen-2-yl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 76780138 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-[1-[5-(hydroxycarbamoyl)thiophen-2-yl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)c2ccc(C(=O)NO)s2)sc2ccccc12 |
| InChI | InChI=1S/C17H16N2O3S2/c1-9-11-5-3-4-6-13(11)24-15(9)17(21)18-10(2)12-7-8-14(23-12)16(20)19-22/h3-8,10,22H,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | WJJPNAALJDKQHP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|