C10H12N4O — CID 103802199
5-methoxy-N-(1H-pyrazol-4-ylmethyl)pyridin-2-amine (PubChem CID 103802199) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-methoxy-N-(1H-pyrazol-4-ylmethyl)pyridin-2-amine.
| Compound Name | 5-methoxy-N-(1H-pyrazol-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103802199 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-methoxy-N-(1H-pyrazol-4-ylmethyl)pyridin-2-amine |
| SMILES | COc1ccc(NCc2cn[nH]c2)nc1 |
| InChI | InChI=1S/C10H12N4O/c1-15-9-2-3-10(12-7-9)11-4-8-5-13-14-6-8/h2-3,5-7H,4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | GBSHYXFMOSIWIA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |