C8H8ClN5 — CID 106193467
6-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine (PubChem CID 106193467) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 6-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine.
| Compound Name | 6-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106193467 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-chloro-N-(1H-pyrazol-4-ylmethyl)pyrazin-2-amine |
| SMILES | Clc1cncc(NCc2cn[nH]c2)n1 |
| InChI | InChI=1S/C8H8ClN5/c9-7-4-10-5-8(14-7)11-1-6-2-12-13-3-6/h2-5H,1H2,(H,11,14)(H,12,13) |
| InChIKey | DEUPAMHPRSQTEF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |