C10H12ClN5 — CID 106193475
6-chloro-2-ethyl-N-(1H-pyrazol-4-ylmethyl)pyrimidin-4-amine (PubChem CID 106193475) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 6-chloro-2-ethyl-N-(1H-pyrazol-4-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-ethyl-N-(1H-pyrazol-4-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106193475 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-chloro-2-ethyl-N-(1H-pyrazol-4-ylmethyl)pyrimidin-4-amine |
| SMILES | CCc1nc(Cl)cc(NCc2cn[nH]c2)n1 |
| InChI | InChI=1S/C10H12ClN5/c1-2-9-15-8(11)3-10(16-9)12-4-7-5-13-14-6-7/h3,5-6H,2,4H2,1H3,(H,13,14)(H,12,15,16) |
| InChIKey | JNELRCNHQVTDDR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |