C17H20O3S — CID 10380327
[1-(3-oxocyclohexen-1-yl)-3-phenylsulfanylpropyl] acetate (PubChem CID 10380327) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is [1-(3-oxocyclohexen-1-yl)-3-phenylsulfanylpropyl] acetate.
| Compound Name | [1-(3-oxocyclohexen-1-yl)-3-phenylsulfanylpropyl] acetate |
|---|---|
| PubChem CID | 10380327 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [1-(3-oxocyclohexen-1-yl)-3-phenylsulfanylpropyl] acetate |
| SMILES | CC(=O)OC(CCSc1ccccc1)C1=CC(=O)CCC1 |
| InChI | InChI=1S/C17H20O3S/c1-13(18)20-17(14-6-5-7-15(19)12-14)10-11-21-16-8-3-2-4-9-16/h2-4,8-9,12,17H,5-7,10-11H2,1H3 |
| InChIKey | YQBWSAZHKJBCKA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |