C21H24O3S — CID 57326845
(4S,5S,7E,10S)-5,9,9-trimethyl-4-phenylsulfanyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione (PubChem CID 57326845) has the molecular formula C21H24O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is (4S,5S,7E,10S)-5,9,9-trimethyl-4-phenylsulfanyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione.
| Compound Name | (4S,5S,7E,10S)-5,9,9-trimethyl-4-phenylsulfanyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione |
|---|---|
| PubChem CID | 57326845 |
| Molecular Formula | C21H24O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (4S,5S,7E,10S)-5,9,9-trimethyl-4-phenylsulfanyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione |
| SMILES | C[C@H]1C(=O)/C=C/C(C)(C)[C@@H]2C=C(CC[C@@H]1Sc1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C21H24O3S/c1-14-17(22)11-12-21(2,3)19-13-15(20(23)24-19)9-10-18(14)25-16-7-5-4-6-8-16/h4-8,11-14,18-19H,9-10H2,1-3H3/b12-11+/t14-,18-,19-/m0/s1 |
| InChIKey | SODGUPVHXIKFHV-OSHRSNGKSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |