C21H20F2O3S — CID 122188967
(3S,3aS,5aS,9bS)-3-[(3,4-difluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 122188967) has the molecular formula C21H20F2O3S and a molecular weight of 390.45 g/mol. Its IUPAC name is (3S,3aS,5aS,9bS)-3-[(3,4-difluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,3aS,5aS,9bS)-3-[(3,4-difluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 122188967 |
| Molecular Formula | C21H20F2O3S |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (3S,3aS,5aS,9bS)-3-[(3,4-difluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@@H](CSc4ccc(F)c(F)c4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C21H20F2O3S/c1-11-17(24)6-8-21(2)7-5-13-14(20(25)26-19(13)18(11)21)10-27-12-3-4-15(22)16(23)9-12/h3-4,6,8-9,13-14,19H,5,7,10H2,1-2H3/t13-,14-,19-,21-/m0/s1 |
| InChIKey | BWGYMNPHIRCVOK-UROBGFMISA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |