C19H38OSi — CID 10380722
tert-butyl-(3-tert-butyl-6,6-dimethylhepta-3,4-dienoxy)-dimethylsilane (PubChem CID 10380722) has the molecular formula C19H38OSi and a molecular weight of 310.60 g/mol. Its IUPAC name is tert-butyl-(3-tert-butyl-6,6-dimethylhepta-3,4-dienoxy)-dimethylsilane.
| Compound Name | tert-butyl-(3-tert-butyl-6,6-dimethylhepta-3,4-dienoxy)-dimethylsilane |
|---|---|
| PubChem CID | 10380722 |
| Molecular Formula | C19H38OSi |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | tert-butyl-(3-tert-butyl-6,6-dimethylhepta-3,4-dienoxy)-dimethylsilane |
| SMILES | CC(C)(C)C=C=C(CCO[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38OSi/c1-17(2,3)14-12-16(18(4,5)6)13-15-20-21(10,11)19(7,8)9/h14H,13,15H2,1-11H3 |
| InChIKey | NJVQSNCLMVVKQW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|