C18H38OSi — CID 100973090
[(2S)-2-ethenyl-4,4-dimethylpentoxy]-tri(propan-2-yl)silane (PubChem CID 100973090) has the molecular formula C18H38OSi and a molecular weight of 298.59 g/mol. Its IUPAC name is [(2S)-2-ethenyl-4,4-dimethylpentoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2S)-2-ethenyl-4,4-dimethylpentoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 100973090 |
| Molecular Formula | C18H38OSi |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | [(2S)-2-ethenyl-4,4-dimethylpentoxy]-tri(propan-2-yl)silane |
| SMILES | C=C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H38OSi/c1-11-17(12-18(8,9)10)13-19-20(14(2)3,15(4)5)16(6)7/h11,14-17H,1,12-13H2,2-10H3/t17-/m1/s1 |
| InChIKey | GIABRELESITNKA-QGZVFWFLSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|