C23H50O2Si2 — CID 10525893
tert-butyl-[(2R,3R,4R)-2,4-dimethyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 10525893) has the molecular formula C23H50O2Si2 and a molecular weight of 414.82 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,4R)-2,4-dimethyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R,4R)-2,4-dimethyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10525893 |
| Molecular Formula | C23H50O2Si2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | tert-butyl-[(2R,3R,4R)-2,4-dimethyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H50O2Si2/c1-15-20(8)22(25-26(13,14)23(10,11)12)21(9)16-24-27(17(2)3,18(4)5)19(6)7/h15,17-22H,1,16H2,2-14H3/t20-,21-,22-/m1/s1 |
| InChIKey | FBXXPZXLBWFVJJ-YPAWHYETSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|