C15H20O7 — CID 10380791
[(2R,3S)-3-but-3-en-2-yl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dioxooxolan-3-yl] acetate (PubChem CID 10380791) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is [(2R,3S)-3-but-3-en-2-yl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dioxooxolan-3-yl] acetate.
| Compound Name | [(2R,3S)-3-but-3-en-2-yl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dioxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10380791 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [(2R,3S)-3-but-3-en-2-yl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dioxooxolan-3-yl] acetate |
| SMILES | C=CC(C)[C@@]1(OC(C)=O)C(=O)C(=O)O[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H20O7/c1-6-8(2)15(21-9(3)16)11(17)13(18)20-12(15)10-7-19-14(4,5)22-10/h6,8,10,12H,1,7H2,2-5H3/t8?,10-,12+,15+/m0/s1 |
| InChIKey | YNBUGDNVRZNGNV-MWKFOGAVSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|