C9H18N2O3S — CID 103810948
1-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(ethylamino)ethanone (PubChem CID 103810948) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(ethylamino)ethanone.
| Compound Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(ethylamino)ethanone |
|---|---|
| PubChem CID | 103810948 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2-(ethylamino)ethanone |
| SMILES | CCNCC(=O)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H18N2O3S/c1-2-10-8-9(12)11-4-3-6-15(13,14)7-5-11/h10H,2-8H2,1H3 |
| InChIKey | GDHOQQBYQFFFBZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |