C10H20N2O3S — CID 103796728
(2R)-2-amino-1-(1,1-dioxo-1,4-thiazepan-4-yl)pentan-1-one (PubChem CID 103796728) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is (2R)-2-amino-1-(1,1-dioxo-1,4-thiazepan-4-yl)pentan-1-one.
| Compound Name | (2R)-2-amino-1-(1,1-dioxo-1,4-thiazepan-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 103796728 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2R)-2-amino-1-(1,1-dioxo-1,4-thiazepan-4-yl)pentan-1-one |
| SMILES | CCC[C@@H](N)C(=O)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H20N2O3S/c1-2-4-9(11)10(13)12-5-3-7-16(14,15)8-6-12/h9H,2-8,11H2,1H3/t9-/m1/s1 |
| InChIKey | GEVJYCODDCQBCU-SECBINFHSA-N |
| XLogP | -0.24 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |