C11H20N2O2 — CID 103811312
N-[(2,2-dimethylcyclopropyl)methyl]morpholine-3-carboxamide (PubChem CID 103811312) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[(2,2-dimethylcyclopropyl)methyl]morpholine-3-carboxamide.
| Compound Name | N-[(2,2-dimethylcyclopropyl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 103811312 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[(2,2-dimethylcyclopropyl)methyl]morpholine-3-carboxamide |
| SMILES | CC1(C)CC1CNC(=O)C1COCCN1 |
| InChI | InChI=1S/C11H20N2O2/c1-11(2)5-8(11)6-13-10(14)9-7-15-4-3-12-9/h8-9,12H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | RXUMDMDPVWCZDA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |