C14H24N2O — CID 103811837
(2S)-N,N-bis(cyclopropylmethyl)piperidine-2-carboxamide (PubChem CID 103811837) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2S)-N,N-bis(cyclopropylmethyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N,N-bis(cyclopropylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 103811837 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2S)-N,N-bis(cyclopropylmethyl)piperidine-2-carboxamide |
| SMILES | O=C([C@@H]1CCCCN1)N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C14H24N2O/c17-14(13-3-1-2-8-15-13)16(9-11-4-5-11)10-12-6-7-12/h11-13,15H,1-10H2/t13-/m0/s1 |
| InChIKey | NBLWJLGXPVXUOM-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |