C12H21ClN2O — CID 53410651
N,N-bis(prop-2-enyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 53410651) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | N,N-bis(prop-2-enyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 53410651 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N,N-bis(prop-2-enyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | C=CCN(CC=C)C(=O)C1CCCCN1.Cl |
| InChI | InChI=1S/C12H20N2O.ClH/c1-3-9-14(10-4-2)12(15)11-7-5-6-8-13-11;/h3-4,11,13H,1-2,5-10H2;1H |
| InChIKey | FAUAOMWGRFNQSG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|