C14H22N2O — CID 103813127
2-pyrrolidin-2-yl-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide (PubChem CID 103813127) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide.
| Compound Name | 2-pyrrolidin-2-yl-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide |
|---|---|
| PubChem CID | 103813127 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-(3-tricyclo[3.2.1.02,4]octanyl)acetamide |
| SMILES | O=C(CC1CCCN1)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C14H22N2O/c17-11(7-10-2-1-5-15-10)16-14-12-8-3-4-9(6-8)13(12)14/h8-10,12-15H,1-7H2,(H,16,17) |
| InChIKey | YVLDUWQXOUWJQL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |