C14H22N2O — CID 113267316
(2R)-N-(3-tricyclo[3.2.1.02,4]octanyl)piperidine-2-carboxamide (PubChem CID 113267316) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R)-N-(3-tricyclo[3.2.1.02,4]octanyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-(3-tricyclo[3.2.1.02,4]octanyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 113267316 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (2R)-N-(3-tricyclo[3.2.1.02,4]octanyl)piperidine-2-carboxamide |
| SMILES | O=C(NC1C2C3CCC(C3)C12)[C@H]1CCCCN1 |
| InChI | InChI=1S/C14H22N2O/c17-14(10-3-1-2-6-15-10)16-13-11-8-4-5-9(7-8)12(11)13/h8-13,15H,1-7H2,(H,16,17)/t8?,9?,10-,11?,12?,13?/m1/s1 |
| InChIKey | HPOBXRBQPGKAGX-VPQSPBFGSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |