C14H25NOS2 — CID 103816316
1-[(5-tert-butylthiophen-2-yl)methylamino]-2-methyl-3-methylsulfanylpropan-2-ol (PubChem CID 103816316) has the molecular formula C14H25NOS2 and a molecular weight of 287.49 g/mol. Its IUPAC name is 1-[(5-tert-butylthiophen-2-yl)methylamino]-2-methyl-3-methylsulfanylpropan-2-ol.
| Compound Name | 1-[(5-tert-butylthiophen-2-yl)methylamino]-2-methyl-3-methylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 103816316 |
| Molecular Formula | C14H25NOS2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(5-tert-butylthiophen-2-yl)methylamino]-2-methyl-3-methylsulfanylpropan-2-ol |
| SMILES | CSCC(C)(O)CNCc1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H25NOS2/c1-13(2,3)12-7-6-11(18-12)8-15-9-14(4,16)10-17-5/h6-7,15-16H,8-10H2,1-5H3 |
| InChIKey | VZQWVJZOYNDYDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |