C18H18ClN3O — CID 10381810
3-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (PubChem CID 10381810) has the molecular formula C18H18ClN3O and a molecular weight of 327.81 g/mol. Its IUPAC name is 3-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine.
| Compound Name | 3-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 10381810 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C18H18ClN3O/c1-21-8-10-22(11-9-21)18-14-4-2-3-5-16(14)23-17-7-6-13(19)12-15(17)20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | AWHNHDGHHNGACT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |