C15H28N4O4 — CID 10381857
3-[[1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 10381857) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[[1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10381857 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 3-[[1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)N1CCCC(C(=O)NCCC(=O)O)C1 |
| InChI | InChI=1S/C15H28N4O4/c16-7-2-1-5-12(17)15(23)19-9-3-4-11(10-19)14(22)18-8-6-13(20)21/h11-12H,1-10,16-17H2,(H,18,22)(H,20,21)/t11?,12-/m0/s1 |
| InChIKey | IDKGSEXQIHVYLO-KIYNQFGBSA-N |
| XLogP | -0.73 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|