C14H25N3O4 — CID 10470027
3-[[2-(4-piperidin-4-ylbutanoylamino)acetyl]amino]propanoic acid (PubChem CID 10470027) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[[2-(4-piperidin-4-ylbutanoylamino)acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(4-piperidin-4-ylbutanoylamino)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10470027 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3-[[2-(4-piperidin-4-ylbutanoylamino)acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CNC(=O)CCCC1CCNCC1 |
| InChI | InChI=1S/C14H25N3O4/c18-12(3-1-2-11-4-7-15-8-5-11)17-10-13(19)16-9-6-14(20)21/h11,15H,1-10H2,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | GSZWBNFDQUBVJY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |