C9H15F2NO3 — CID 103822648
N-(3,3-difluoro-2-hydroxypropyl)oxane-2-carboxamide (PubChem CID 103822648) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)oxane-2-carboxamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 103822648 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)oxane-2-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)C1CCCCO1 |
| InChI | InChI=1S/C9H15F2NO3/c10-8(11)6(13)5-12-9(14)7-3-1-2-4-15-7/h6-8,13H,1-5H2,(H,12,14) |
| InChIKey | ZNSYBJXNVZESEY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |