C8H13F2NO3 — CID 103850586
(2R)-N-(3,3-difluoro-2-hydroxypropyl)oxolane-2-carboxamide (PubChem CID 103850586) has the molecular formula C8H13F2NO3 and a molecular weight of 209.19 g/mol. Its IUPAC name is (2R)-N-(3,3-difluoro-2-hydroxypropyl)oxolane-2-carboxamide.
| Compound Name | (2R)-N-(3,3-difluoro-2-hydroxypropyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 103850586 |
| Molecular Formula | C8H13F2NO3 |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2R)-N-(3,3-difluoro-2-hydroxypropyl)oxolane-2-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)[C@H]1CCCO1 |
| InChI | InChI=1S/C8H13F2NO3/c9-7(10)5(12)4-11-8(13)6-2-1-3-14-6/h5-7,12H,1-4H2,(H,11,13)/t5?,6-/m1/s1 |
| InChIKey | RMUNUQMYBAXLAO-PRJDIBJQSA-N |
| XLogP | -0.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |