C17H22N2O — CID 103823537
3-[(isoquinolin-4-ylmethylamino)methyl]cyclohexan-1-ol (PubChem CID 103823537) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-[(isoquinolin-4-ylmethylamino)methyl]cyclohexan-1-ol.
| Compound Name | 3-[(isoquinolin-4-ylmethylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 103823537 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[(isoquinolin-4-ylmethylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(CNCc2cncc3ccccc23)C1 |
| InChI | InChI=1S/C17H22N2O/c20-16-6-3-4-13(8-16)9-18-11-15-12-19-10-14-5-1-2-7-17(14)15/h1-2,5,7,10,12-13,16,18,20H,3-4,6,8-9,11H2 |
| InChIKey | CTJGBKBGNASJDQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |