C16H20N2 — CID 115748530
2-cyclobutyl-N-(isoquinolin-4-ylmethyl)ethanamine (PubChem CID 115748530) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-cyclobutyl-N-(isoquinolin-4-ylmethyl)ethanamine.
| Compound Name | 2-cyclobutyl-N-(isoquinolin-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115748530 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-cyclobutyl-N-(isoquinolin-4-ylmethyl)ethanamine |
| SMILES | c1ccc2c(CNCCC3CCC3)cncc2c1 |
| InChI | InChI=1S/C16H20N2/c1-2-7-16-14(6-1)10-18-12-15(16)11-17-9-8-13-4-3-5-13/h1-2,6-7,10,12-13,17H,3-5,8-9,11H2 |
| InChIKey | SVURDAZFXXGEOW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|