C18H24O6 — CID 10382367
dimethyl (1R,5R)-1-hept-6-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate (PubChem CID 10382367) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is dimethyl (1R,5R)-1-hept-6-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate.
| Compound Name | dimethyl (1R,5R)-1-hept-6-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 10382367 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | dimethyl (1R,5R)-1-hept-6-enyl-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate |
| SMILES | C=CCCCCC[C@]12CCC(=O)[C@H](O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C18H24O6/c1-4-5-6-7-8-10-18-11-9-12(19)15(24-18)13(16(20)22-2)14(18)17(21)23-3/h4,15H,1,5-11H2,2-3H3/t15-,18+/m0/s1 |
| InChIKey | ZUZAPSOPWOAFOX-MAUKXSAKSA-N |
| XLogP | 2.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|