C13H18F2N2O — CID 103824416
3-[(3,4-difluorophenyl)methylamino]-N,2,2-trimethylpropanamide (PubChem CID 103824416) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(3,4-difluorophenyl)methylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103824416 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-13(2,12(18)16-3)8-17-7-9-4-5-10(14)11(15)6-9/h4-6,17H,7-8H2,1-3H3,(H,16,18) |
| InChIKey | MZGJYMLBFGGBFX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |