C9H15F4NO2 — CID 103825268
2,2,3,3-tetrafluoro-N-(4-hydroxy-2,2-dimethylbutyl)propanamide (PubChem CID 103825268) has the molecular formula C9H15F4NO2 and a molecular weight of 245.22 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(4-hydroxy-2,2-dimethylbutyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(4-hydroxy-2,2-dimethylbutyl)propanamide |
|---|---|
| PubChem CID | 103825268 |
| Molecular Formula | C9H15F4NO2 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(4-hydroxy-2,2-dimethylbutyl)propanamide |
| SMILES | CC(C)(CCO)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H15F4NO2/c1-8(2,3-4-15)5-14-7(16)9(12,13)6(10)11/h6,15H,3-5H2,1-2H3,(H,14,16) |
| InChIKey | CCSMMKRPBASKAN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|