C8H10F7NO2 — CID 3477037
2,2,3,3,4,4,4-heptafluoro-N-(4-hydroxybutyl)butanamide (PubChem CID 3477037) has the molecular formula C8H10F7NO2 and a molecular weight of 285.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(4-hydroxybutyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(4-hydroxybutyl)butanamide |
|---|---|
| PubChem CID | 3477037 |
| Molecular Formula | C8H10F7NO2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(4-hydroxybutyl)butanamide |
| SMILES | O=C(NCCCCO)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7NO2/c9-6(10,7(11,12)8(13,14)15)5(18)16-3-1-2-4-17/h17H,1-4H2,(H,16,18) |
| InChIKey | BCPCXPSYHDLDPB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|