C14H15FN2O2 — CID 103825857
N-[(2,3-dimethoxyphenyl)methyl]-6-fluoropyridin-3-amine (PubChem CID 103825857) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-6-fluoropyridin-3-amine.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-6-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 103825857 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-6-fluoropyridin-3-amine |
| SMILES | COc1cccc(CNc2ccc(F)nc2)c1OC |
| InChI | InChI=1S/C14H15FN2O2/c1-18-12-5-3-4-10(14(12)19-2)8-16-11-6-7-13(15)17-9-11/h3-7,9,16H,8H2,1-2H3 |
| InChIKey | MKXFMXOEGGEKOA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|