About (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol
(2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol (PubChem CID 103825995) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol |
| PubChem CID | 103825995 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol |
| SMILES | COC1(C)CC(N[C@H](C)CO)C1(C)C |
| InChI | InChI=1S/C11H23NO2/c1-8(7-13)12-9-6-11(4,14-5)10(9,2)3/h8-9,12-13H,6-7H2,1-5H3/t8-,9?,11?/m1/s1 |
| InChIKey | GFPADPMAXXSIOK-FKTRJACZSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol?
The IUPAC name of (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol (CID 103825995) is (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol.
What is the SMILES notation for (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol?
The canonical SMILES for (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol is COC1(C)CC(N[C@H](C)CO)C1(C)C.
What is the InChIKey of (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol?
The InChIKey is GFPADPMAXXSIOK-FKTRJACZSA-N. The full InChI is InChI=1S/C11H23NO2/c1-8(7-13)12-9-6-11(4,14-5)10(9,2)3/h8-9,12-13H,6-7H2,1-5H3/t8-,9?,11?/m1/s1.
What are the key properties of (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol?
(2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol has a molecular weight of 201.31 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3-methoxy-2,2,3-trimethylcyclobutyl)amino]propan-1-ol is sourced from PubChem (CID 103825995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).