About 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine
3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine (PubChem CID 115726136) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine |
| PubChem CID | 115726136 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine |
| SMILES | CCC(NC1CC(C)(OC)C1(C)C)C(C)C |
| InChI | InChI=1S/C14H29NO/c1-8-11(10(2)3)15-12-9-14(6,16-7)13(12,4)5/h10-12,15H,8-9H2,1-7H3 |
| InChIKey | OMXLLYITNHXZEV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine?
The IUPAC name of 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine (CID 115726136) is 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine.
What is the SMILES notation for 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine?
The canonical SMILES for 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine is CCC(NC1CC(C)(OC)C1(C)C)C(C)C.
What is the InChIKey of 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine?
The InChIKey is OMXLLYITNHXZEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-8-11(10(2)3)15-12-9-14(6,16-7)13(12,4)5/h10-12,15H,8-9H2,1-7H3.
What are the key properties of 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine?
3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine has a molecular weight of 227.39 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,2,3-trimethyl-N-(2-methylpentan-3-yl)cyclobutan-1-amine is sourced from PubChem (CID 115726136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).