C10H21N3O4S — CID 103827599
2-amino-N-methyl-N-[3-(methylamino)-3-oxopropyl]-4-methylsulfonylbutanamide (PubChem CID 103827599) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[3-(methylamino)-3-oxopropyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-methyl-N-[3-(methylamino)-3-oxopropyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 103827599 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-amino-N-methyl-N-[3-(methylamino)-3-oxopropyl]-4-methylsulfonylbutanamide |
| SMILES | CNC(=O)CCN(C)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H21N3O4S/c1-12-9(14)4-6-13(2)10(15)8(11)5-7-18(3,16)17/h8H,4-7,11H2,1-3H3,(H,12,14) |
| InChIKey | VNOWSWCOXZXALO-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |