C14H14N2O2S — CID 103830677
N-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 103830677) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is N-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 103830677 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-[(5-nitrothiophen-3-yl)methyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | O=[N+]([O-])c1cc(CNC2Cc3ccccc3C2)cs1 |
| InChI | InChI=1S/C14H14N2O2S/c17-16(18)14-5-10(9-19-14)8-15-13-6-11-3-1-2-4-12(11)7-13/h1-5,9,13,15H,6-8H2 |
| InChIKey | OJPKSJMGBYAEIM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|