C13H20N2O2S — CID 64742854
3,4-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]cyclohexan-1-amine (PubChem CID 64742854) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]cyclohexan-1-amine.
| Compound Name | 3,4-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 64742854 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3,4-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]cyclohexan-1-amine |
| SMILES | CC1CCC(NCc2csc([N+](=O)[O-])c2)CC1C |
| InChI | InChI=1S/C13H20N2O2S/c1-9-3-4-12(5-10(9)2)14-7-11-6-13(15(16)17)18-8-11/h6,8-10,12,14H,3-5,7H2,1-2H3 |
| InChIKey | XYATZFKNFFDMML-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|