C11H4Cl3F3O3 — CID 10383075
6,7,8-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 10383075) has the molecular formula C11H4Cl3F3O3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 6,7,8-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6,7,8-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 10383075 |
| Molecular Formula | C11H4Cl3F3O3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 6,7,8-trichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)c(Cl)c(Cl)c2OC1C(F)(F)F |
| InChI | InChI=1S/C11H4Cl3F3O3/c12-5-2-3-1-4(10(18)19)9(11(15,16)17)20-8(3)7(14)6(5)13/h1-2,9H,(H,18,19) |
| InChIKey | RHPWOEFSQBYIMW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|