C14H30N2O3S — CID 103835504
[(2-hydroxy-4,4-dimethylpentyl)sulfamoyl-methylamino]cyclohexane (PubChem CID 103835504) has the molecular formula C14H30N2O3S and a molecular weight of 306.47 g/mol. Its IUPAC name is [(2-hydroxy-4,4-dimethylpentyl)sulfamoyl-methylamino]cyclohexane.
| Compound Name | [(2-hydroxy-4,4-dimethylpentyl)sulfamoyl-methylamino]cyclohexane |
|---|---|
| PubChem CID | 103835504 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | [(2-hydroxy-4,4-dimethylpentyl)sulfamoyl-methylamino]cyclohexane |
| SMILES | CN(C1CCCCC1)S(=O)(=O)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C14H30N2O3S/c1-14(2,3)10-13(17)11-15-20(18,19)16(4)12-8-6-5-7-9-12/h12-13,15,17H,5-11H2,1-4H3 |
| InChIKey | ITRKYEILXQCCEC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |