C13H29N3O2S — CID 43606374
[(2-amino-4-methylpentyl)sulfamoyl-methylamino]cyclohexane (PubChem CID 43606374) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is [(2-amino-4-methylpentyl)sulfamoyl-methylamino]cyclohexane.
| Compound Name | [(2-amino-4-methylpentyl)sulfamoyl-methylamino]cyclohexane |
|---|---|
| PubChem CID | 43606374 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | [(2-amino-4-methylpentyl)sulfamoyl-methylamino]cyclohexane |
| SMILES | CC(C)CC(N)CNS(=O)(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C13H29N3O2S/c1-11(2)9-12(14)10-15-19(17,18)16(3)13-7-5-4-6-8-13/h11-13,15H,4-10,14H2,1-3H3 |
| InChIKey | ONZSRMJCPSVPGB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |