C11H24N2O3S2 — CID 103835694
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-methylpiperidine-1-sulfonamide (PubChem CID 103835694) has the molecular formula C11H24N2O3S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 103835694 |
| Molecular Formula | C11H24N2O3S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-methylpiperidine-1-sulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C11H24N2O3S2/c1-10-5-4-6-13(7-10)18(15,16)12-8-11(2,14)9-17-3/h10,12,14H,4-9H2,1-3H3 |
| InChIKey | CCRXFFZVFXPXPF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |